C13H19NO2S — CID 64923273
N-(2,3-dimethylcyclopentyl)benzenesulfonamide (PubChem CID 64923273) has the molecular formula C13H19NO2S and a molecular weight of 253.37 g/mol. Its IUPAC name is N-(2,3-dimethylcyclopentyl)benzenesulfonamide.
| Compound Name | N-(2,3-dimethylcyclopentyl)benzenesulfonamide |
|---|---|
| PubChem CID | 64923273 |
| Molecular Formula | C13H19NO2S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | N-(2,3-dimethylcyclopentyl)benzenesulfonamide |
| SMILES | CC1CCC(NS(=O)(=O)c2ccccc2)C1C |
| InChI | InChI=1S/C13H19NO2S/c1-10-8-9-13(11(10)2)14-17(15,16)12-6-4-3-5-7-12/h3-7,10-11,13-14H,8-9H2,1-2H3 |
| InChIKey | QWOUIUTWEUFRMC-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |