C13H17N3O2S — CID 114613875
6-cyano-N-(2,3-dimethylcyclopentyl)pyridine-3-sulfonamide (PubChem CID 114613875) has the molecular formula C13H17N3O2S and a molecular weight of 279.37 g/mol. Its IUPAC name is 6-cyano-N-(2,3-dimethylcyclopentyl)pyridine-3-sulfonamide.
| Compound Name | 6-cyano-N-(2,3-dimethylcyclopentyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 114613875 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 6-cyano-N-(2,3-dimethylcyclopentyl)pyridine-3-sulfonamide |
| SMILES | CC1CCC(NS(=O)(=O)c2ccc(C#N)nc2)C1C |
| InChI | InChI=1S/C13H17N3O2S/c1-9-3-6-13(10(9)2)16-19(17,18)12-5-4-11(7-14)15-8-12/h4-5,8-10,13,16H,3,6H2,1-2H3 |
| InChIKey | OGMILFQGHYDUBI-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |