C14H17FN2O2S — CID 64910233
3-cyano-N-(2,3-dimethylcyclopentyl)-4-fluorobenzenesulfonamide (PubChem CID 64910233) has the molecular formula C14H17FN2O2S and a molecular weight of 296.37 g/mol. Its IUPAC name is 3-cyano-N-(2,3-dimethylcyclopentyl)-4-fluorobenzenesulfonamide.
| Compound Name | 3-cyano-N-(2,3-dimethylcyclopentyl)-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 64910233 |
| Molecular Formula | C14H17FN2O2S |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 3-cyano-N-(2,3-dimethylcyclopentyl)-4-fluorobenzenesulfonamide |
| SMILES | CC1CCC(NS(=O)(=O)c2ccc(F)c(C#N)c2)C1C |
| InChI | InChI=1S/C14H17FN2O2S/c1-9-3-6-14(10(9)2)17-20(18,19)12-4-5-13(15)11(7-12)8-16/h4-5,7,9-10,14,17H,3,6H2,1-2H3 |
| InChIKey | RSLXLJVLQHEFHZ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |