C12H13FN2O2S — CID 55172697
3-cyano-N-(2,2-dimethylcyclopropyl)-4-fluorobenzenesulfonamide (PubChem CID 55172697) has the molecular formula C12H13FN2O2S and a molecular weight of 268.31 g/mol. Its IUPAC name is 3-cyano-N-(2,2-dimethylcyclopropyl)-4-fluorobenzenesulfonamide.
| Compound Name | 3-cyano-N-(2,2-dimethylcyclopropyl)-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 55172697 |
| Molecular Formula | C12H13FN2O2S |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 3-cyano-N-(2,2-dimethylcyclopropyl)-4-fluorobenzenesulfonamide |
| SMILES | CC1(C)CC1NS(=O)(=O)c1ccc(F)c(C#N)c1 |
| InChI | InChI=1S/C12H13FN2O2S/c1-12(2)6-11(12)15-18(16,17)9-3-4-10(13)8(5-9)7-14/h3-5,11,15H,6H2,1-2H3 |
| InChIKey | XRCACMHWTFLJLW-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |