C15H20NO4S- — CID 11916136
3-[[(1R,2R,3R)-2,3-dimethylcyclohexyl]sulfamoyl]benzoate (PubChem CID 11916136) has the molecular formula C15H20NO4S- and a molecular weight of 310.39 g/mol. Its IUPAC name is 3-[[(1R,2R,3R)-2,3-dimethylcyclohexyl]sulfamoyl]benzoate.
| Compound Name | 3-[[(1R,2R,3R)-2,3-dimethylcyclohexyl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 11916136 |
| Molecular Formula | C15H20NO4S- |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 3-[[(1R,2R,3R)-2,3-dimethylcyclohexyl]sulfamoyl]benzoate |
| SMILES | C[C@@H]1[C@H](C)CCC[C@H]1NS(=O)(=O)c1cccc(C(=O)[O-])c1 |
| InChI | InChI=1S/C15H21NO4S/c1-10-5-3-8-14(11(10)2)16-21(19,20)13-7-4-6-12(9-13)15(17)18/h4,6-7,9-11,14,16H,3,5,8H2,1-2H3,(H,17,18)/p-1/t10-,11-,14-/m1/s1 |
| InChIKey | AEOULEMWISPJTA-JTNHKYCSSA-M |
| XLogP | 1.15 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |