C14H19NO4S — CID 61068578
4-acetyl-N-(3-hydroxycyclohexyl)benzenesulfonamide (PubChem CID 61068578) has the molecular formula C14H19NO4S and a molecular weight of 297.38 g/mol. Its IUPAC name is 4-acetyl-N-(3-hydroxycyclohexyl)benzenesulfonamide.
| Compound Name | 4-acetyl-N-(3-hydroxycyclohexyl)benzenesulfonamide |
|---|---|
| PubChem CID | 61068578 |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 4-acetyl-N-(3-hydroxycyclohexyl)benzenesulfonamide |
| SMILES | CC(=O)c1ccc(S(=O)(=O)NC2CCCC(O)C2)cc1 |
| InChI | InChI=1S/C14H19NO4S/c1-10(16)11-5-7-14(8-6-11)20(18,19)15-12-3-2-4-13(17)9-12/h5-8,12-13,15,17H,2-4,9H2,1H3 |
| InChIKey | AQLNERYXCFFLGI-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |