C14H18NO4S- — CID 6943892
trans-(1R,3R)-3-[(4-methylphenyl)sulfonylamino]cyclohexane-1-carboxylate (PubChem CID 6943892) has the molecular formula C14H18NO4S- and a molecular weight of 296.37 g/mol. Its IUPAC name is trans-(1R,3R)-3-[(4-methylphenyl)sulfonylamino]cyclohexane-1-carboxylate.
| Compound Name | trans-(1R,3R)-3-[(4-methylphenyl)sulfonylamino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 6943892 |
| Molecular Formula | C14H18NO4S- |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | trans-(1R,3R)-3-[(4-methylphenyl)sulfonylamino]cyclohexane-1-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H]2CCC[C@@H](C(=O)[O-])C2)cc1 |
| InChI | InChI=1S/C14H19NO4S/c1-10-5-7-13(8-6-10)20(18,19)15-12-4-2-3-11(9-12)14(16)17/h5-8,11-12,15H,2-4,9H2,1H3,(H,16,17)/p-1/t11-,12-/m1/s1 |
| InChIKey | HIMLZRXNJNAMFK-VXGBXAGGSA-M |
| XLogP | 0.58 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |