C14H18F3NO2S — CID 32684915
4-methyl-N-[(1S,3R)-3-(trifluoromethyl)cyclohexyl]benzenesulfonamide (PubChem CID 32684915) has the molecular formula C14H18F3NO2S and a molecular weight of 321.36 g/mol. Its IUPAC name is 4-methyl-N-[(1S,3R)-3-(trifluoromethyl)cyclohexyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[(1S,3R)-3-(trifluoromethyl)cyclohexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 32684915 |
| Molecular Formula | C14H18F3NO2S |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 4-methyl-N-[(1S,3R)-3-(trifluoromethyl)cyclohexyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@H]2CCC[C@@H](C(F)(F)F)C2)cc1 |
| InChI | InChI=1S/C14H18F3NO2S/c1-10-5-7-13(8-6-10)21(19,20)18-12-4-2-3-11(9-12)14(15,16)17/h5-8,11-12,18H,2-4,9H2,1H3/t11-,12+/m1/s1 |
| InChIKey | IHLOAGYWSPWYPD-NEPJUHHUSA-N |
| XLogP | 3.39 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |