C11H16F3N3O2S — CID 61275605
5-methyl-N-[3-(trifluoromethyl)cyclohexyl]-1H-pyrazole-4-sulfonamide (PubChem CID 61275605) has the molecular formula C11H16F3N3O2S and a molecular weight of 311.33 g/mol. Its IUPAC name is 5-methyl-N-[3-(trifluoromethyl)cyclohexyl]-1H-pyrazole-4-sulfonamide.
| Compound Name | 5-methyl-N-[3-(trifluoromethyl)cyclohexyl]-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 61275605 |
| Molecular Formula | C11H16F3N3O2S |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 5-methyl-N-[3-(trifluoromethyl)cyclohexyl]-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1[nH]ncc1S(=O)(=O)NC1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C11H16F3N3O2S/c1-7-10(6-15-16-7)20(18,19)17-9-4-2-3-8(5-9)11(12,13)14/h6,8-9,17H,2-5H2,1H3,(H,15,16) |
| InChIKey | MRPOQHQTIRKAMV-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |