C8H14F3NO2S — CID 129369369
N-[(1R,3S)-3-(trifluoromethyl)cyclohexyl]methanesulfonamide (PubChem CID 129369369) has the molecular formula C8H14F3NO2S and a molecular weight of 245.27 g/mol. Its IUPAC name is N-[(1R,3S)-3-(trifluoromethyl)cyclohexyl]methanesulfonamide.
| Compound Name | N-[(1R,3S)-3-(trifluoromethyl)cyclohexyl]methanesulfonamide |
|---|---|
| PubChem CID | 129369369 |
| Molecular Formula | C8H14F3NO2S |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | N-[(1R,3S)-3-(trifluoromethyl)cyclohexyl]methanesulfonamide |
| SMILES | CS(=O)(=O)N[C@@H]1CCC[C@H](C(F)(F)F)C1 |
| InChI | InChI=1S/C8H14F3NO2S/c1-15(13,14)12-7-4-2-3-6(5-7)8(9,10)11/h6-7,12H,2-5H2,1H3/t6-,7+/m0/s1 |
| InChIKey | NGYTUPNYBALIQU-NKWVEPMBSA-N |
| XLogP | 1.66 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |