C11H19F3N2O3S — CID 95266419
N-[(1R,3S)-3-(trifluoromethyl)cyclohexyl]morpholine-4-sulfonamide (PubChem CID 95266419) has the molecular formula C11H19F3N2O3S and a molecular weight of 316.35 g/mol. Its IUPAC name is N-[(1R,3S)-3-(trifluoromethyl)cyclohexyl]morpholine-4-sulfonamide.
| Compound Name | N-[(1R,3S)-3-(trifluoromethyl)cyclohexyl]morpholine-4-sulfonamide |
|---|---|
| PubChem CID | 95266419 |
| Molecular Formula | C11H19F3N2O3S |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | N-[(1R,3S)-3-(trifluoromethyl)cyclohexyl]morpholine-4-sulfonamide |
| SMILES | O=S(=O)(N[C@@H]1CCC[C@H](C(F)(F)F)C1)N1CCOCC1 |
| InChI | InChI=1S/C11H19F3N2O3S/c12-11(13,14)9-2-1-3-10(8-9)15-20(17,18)16-4-6-19-7-5-16/h9-10,15H,1-8H2/t9-,10+/m0/s1 |
| InChIKey | TUDZUKGKPMPIDA-VHSXEESVSA-N |
| XLogP | 1.27 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |