C16H21F3N2O4S2 — CID 55535803
3-morpholin-4-ylsulfonyl-N-[3-(trifluoromethyl)cyclohexyl]thiophene-2-carboxamide (PubChem CID 55535803) has the molecular formula C16H21F3N2O4S2 and a molecular weight of 426.48 g/mol. Its IUPAC name is 3-morpholin-4-ylsulfonyl-N-[3-(trifluoromethyl)cyclohexyl]thiophene-2-carboxamide.
| Compound Name | 3-morpholin-4-ylsulfonyl-N-[3-(trifluoromethyl)cyclohexyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 55535803 |
| Molecular Formula | C16H21F3N2O4S2 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | 3-morpholin-4-ylsulfonyl-N-[3-(trifluoromethyl)cyclohexyl]thiophene-2-carboxamide |
| SMILES | O=C(NC1CCCC(C(F)(F)F)C1)c1sccc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C16H21F3N2O4S2/c17-16(18,19)11-2-1-3-12(10-11)20-15(22)14-13(4-9-26-14)27(23,24)21-5-7-25-8-6-21/h4,9,11-12H,1-3,5-8,10H2,(H,20,22) |
| InChIKey | OYILPSVTXMBQKW-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |