C22H28FN3O3S2 — CID 27374234
N-cycloheptyl-3-[4-(4-fluorophenyl)piperazin-1-yl]sulfonylthiophene-2-carboxamide (PubChem CID 27374234) has the molecular formula C22H28FN3O3S2 and a molecular weight of 465.62 g/mol. Its IUPAC name is N-cycloheptyl-3-[4-(4-fluorophenyl)piperazin-1-yl]sulfonylthiophene-2-carboxamide.
| Compound Name | N-cycloheptyl-3-[4-(4-fluorophenyl)piperazin-1-yl]sulfonylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 27374234 |
| Molecular Formula | C22H28FN3O3S2 |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | N-cycloheptyl-3-[4-(4-fluorophenyl)piperazin-1-yl]sulfonylthiophene-2-carboxamide |
| SMILES | O=C(NC1CCCCCC1)c1sccc1S(=O)(=O)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C22H28FN3O3S2/c23-17-7-9-19(10-8-17)25-12-14-26(15-13-25)31(28,29)20-11-16-30-21(20)22(27)24-18-5-3-1-2-4-6-18/h7-11,16,18H,1-6,12-15H2,(H,24,27) |
| InChIKey | ZBAWNRFKXWOCBN-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |