C21H25FN4O — CID 109182203
N-cyclopentyl-5-[4-(4-fluorophenyl)piperazin-1-yl]pyridine-2-carboxamide (PubChem CID 109182203) has the molecular formula C21H25FN4O and a molecular weight of 368.46 g/mol. Its IUPAC name is N-cyclopentyl-5-[4-(4-fluorophenyl)piperazin-1-yl]pyridine-2-carboxamide.
| Compound Name | N-cyclopentyl-5-[4-(4-fluorophenyl)piperazin-1-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109182203 |
| Molecular Formula | C21H25FN4O |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | N-cyclopentyl-5-[4-(4-fluorophenyl)piperazin-1-yl]pyridine-2-carboxamide |
| SMILES | O=C(NC1CCCC1)c1ccc(N2CCN(c3ccc(F)cc3)CC2)cn1 |
| InChI | InChI=1S/C21H25FN4O/c22-16-5-7-18(8-6-16)25-11-13-26(14-12-25)19-9-10-20(23-15-19)21(27)24-17-3-1-2-4-17/h5-10,15,17H,1-4,11-14H2,(H,24,27) |
| InChIKey | GWVOXLACCPGCQE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |