C20H26N6O — CID 109182962
N-cyclohexyl-5-(4-pyrimidin-2-ylpiperazin-1-yl)pyridine-2-carboxamide (PubChem CID 109182962) has the molecular formula C20H26N6O and a molecular weight of 366.47 g/mol. Its IUPAC name is N-cyclohexyl-5-(4-pyrimidin-2-ylpiperazin-1-yl)pyridine-2-carboxamide.
| Compound Name | N-cyclohexyl-5-(4-pyrimidin-2-ylpiperazin-1-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109182962 |
| Molecular Formula | C20H26N6O |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | N-cyclohexyl-5-(4-pyrimidin-2-ylpiperazin-1-yl)pyridine-2-carboxamide |
| SMILES | O=C(NC1CCCCC1)c1ccc(N2CCN(c3ncccn3)CC2)cn1 |
| InChI | InChI=1S/C20H26N6O/c27-19(24-16-5-2-1-3-6-16)18-8-7-17(15-23-18)25-11-13-26(14-12-25)20-21-9-4-10-22-20/h4,7-10,15-16H,1-3,5-6,11-14H2,(H,24,27) |
| InChIKey | DGSISBGZFPQTCL-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |