C16H25N5O — CID 108990409
N-cycloheptyl-4-pyrimidin-2-ylpiperazine-1-carboxamide (PubChem CID 108990409) has the molecular formula C16H25N5O and a molecular weight of 303.41 g/mol. Its IUPAC name is N-cycloheptyl-4-pyrimidin-2-ylpiperazine-1-carboxamide.
| Compound Name | N-cycloheptyl-4-pyrimidin-2-ylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 108990409 |
| Molecular Formula | C16H25N5O |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.21 |
| IUPAC Name | N-cycloheptyl-4-pyrimidin-2-ylpiperazine-1-carboxamide |
| SMILES | O=C(NC1CCCCCC1)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C16H25N5O/c22-16(19-14-6-3-1-2-4-7-14)21-12-10-20(11-13-21)15-17-8-5-9-18-15/h5,8-9,14H,1-4,6-7,10-13H2,(H,19,22) |
| InChIKey | ZAMXKYBNFIIZDR-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |