C22H33N5O2 — CID 109146126
N-cyclohexyl-4-(4-pyrimidin-2-ylpiperazine-1-carbonyl)cyclohexane-1-carboxamide (PubChem CID 109146126) has the molecular formula C22H33N5O2 and a molecular weight of 399.54 g/mol. Its IUPAC name is N-cyclohexyl-4-(4-pyrimidin-2-ylpiperazine-1-carbonyl)cyclohexane-1-carboxamide.
| Compound Name | N-cyclohexyl-4-(4-pyrimidin-2-ylpiperazine-1-carbonyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 109146126 |
| Molecular Formula | C22H33N5O2 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.26 |
| IUPAC Name | N-cyclohexyl-4-(4-pyrimidin-2-ylpiperazine-1-carbonyl)cyclohexane-1-carboxamide |
| SMILES | O=C(NC1CCCCC1)C1CCC(C(=O)N2CCN(c3ncccn3)CC2)CC1 |
| InChI | InChI=1S/C22H33N5O2/c28-20(25-19-5-2-1-3-6-19)17-7-9-18(10-8-17)21(29)26-13-15-27(16-14-26)22-23-11-4-12-24-22/h4,11-12,17-19H,1-3,5-10,13-16H2,(H,25,28) |
| InChIKey | FFEDNBATJVBCLM-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |