C14H23Cl2N5O — CID 119827947
piperidin-4-yl-(4-pyrimidin-2-ylpiperazin-1-yl)methanone;dihydrochloride (PubChem CID 119827947) has the molecular formula C14H23Cl2N5O and a molecular weight of 348.28 g/mol. Its IUPAC name is piperidin-4-yl-(4-pyrimidin-2-ylpiperazin-1-yl)methanone;dihydrochloride.
| Compound Name | piperidin-4-yl-(4-pyrimidin-2-ylpiperazin-1-yl)methanone;dihydrochloride |
|---|---|
| PubChem CID | 119827947 |
| Molecular Formula | C14H23Cl2N5O |
| Molecular Weight | 348.28 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | piperidin-4-yl-(4-pyrimidin-2-ylpiperazin-1-yl)methanone;dihydrochloride |
| SMILES | Cl.Cl.O=C(C1CCNCC1)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C14H21N5O.2ClH/c20-13(12-2-6-15-7-3-12)18-8-10-19(11-9-18)14-16-4-1-5-17-14;;/h1,4-5,12,15H,2-3,6-11H2;2*1H |
| InChIKey | KKNVNOWVPXRUTI-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.28 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |