C16H24Cl3N3O — CID 119827691
[4-(2-chlorophenyl)piperazin-1-yl]-piperidin-4-ylmethanone;dihydrochloride (PubChem CID 119827691) has the molecular formula C16H24Cl3N3O and a molecular weight of 380.75 g/mol. Its IUPAC name is [4-(2-chlorophenyl)piperazin-1-yl]-piperidin-4-ylmethanone;dihydrochloride.
| Compound Name | [4-(2-chlorophenyl)piperazin-1-yl]-piperidin-4-ylmethanone;dihydrochloride |
|---|---|
| PubChem CID | 119827691 |
| Molecular Formula | C16H24Cl3N3O |
| Molecular Weight | 380.75 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | [4-(2-chlorophenyl)piperazin-1-yl]-piperidin-4-ylmethanone;dihydrochloride |
| SMILES | Cl.Cl.O=C(C1CCNCC1)N1CCN(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C16H22ClN3O.2ClH/c17-14-3-1-2-4-15(14)19-9-11-20(12-10-19)16(21)13-5-7-18-8-6-13;;/h1-4,13,18H,5-12H2;2*1H |
| InChIKey | CZLDBAMFOUGMIY-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.75 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |