C15H21Cl2N3O — CID 18545111
[4-(2-chlorophenyl)piperazin-1-yl]-pyrrolidin-2-ylmethanone;hydrochloride (PubChem CID 18545111) has the molecular formula C15H21Cl2N3O and a molecular weight of 330.26 g/mol. Its IUPAC name is [4-(2-chlorophenyl)piperazin-1-yl]-pyrrolidin-2-ylmethanone;hydrochloride.
| Compound Name | [4-(2-chlorophenyl)piperazin-1-yl]-pyrrolidin-2-ylmethanone;hydrochloride |
|---|---|
| PubChem CID | 18545111 |
| Molecular Formula | C15H21Cl2N3O |
| Molecular Weight | 330.26 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | [4-(2-chlorophenyl)piperazin-1-yl]-pyrrolidin-2-ylmethanone;hydrochloride |
| SMILES | Cl.O=C(C1CCCN1)N1CCN(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C15H20ClN3O.ClH/c16-12-4-1-2-6-14(12)18-8-10-19(11-9-18)15(20)13-5-3-7-17-13;/h1-2,4,6,13,17H,3,5,7-11H2;1H |
| InChIKey | LQRIDFDCYJQFEZ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.26 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |