C16H21Cl2N3O — CID 143238076
[4-(2,4-dichlorophenyl)piperazin-1-yl]-piperidin-4-ylmethanone (PubChem CID 143238076) has the molecular formula C16H21Cl2N3O and a molecular weight of 342.27 g/mol. Its IUPAC name is [4-(2,4-dichlorophenyl)piperazin-1-yl]-piperidin-4-ylmethanone.
| Compound Name | [4-(2,4-dichlorophenyl)piperazin-1-yl]-piperidin-4-ylmethanone |
|---|---|
| PubChem CID | 143238076 |
| Molecular Formula | C16H21Cl2N3O |
| Molecular Weight | 342.27 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | [4-(2,4-dichlorophenyl)piperazin-1-yl]-piperidin-4-ylmethanone |
| SMILES | O=C(C1CCNCC1)N1CCN(c2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C16H21Cl2N3O/c17-13-1-2-15(14(18)11-13)20-7-9-21(10-8-20)16(22)12-3-5-19-6-4-12/h1-2,11-12,19H,3-10H2 |
| InChIKey | JMVBXTLBNDAZTP-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.27 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |