C15H18Cl2N2O2 — CID 113080191
[4-(2,4-dichlorophenyl)piperazin-1-yl]-(oxolan-2-yl)methanone (PubChem CID 113080191) has the molecular formula C15H18Cl2N2O2 and a molecular weight of 329.23 g/mol. Its IUPAC name is [4-(2,4-dichlorophenyl)piperazin-1-yl]-(oxolan-2-yl)methanone.
| Compound Name | [4-(2,4-dichlorophenyl)piperazin-1-yl]-(oxolan-2-yl)methanone |
|---|---|
| PubChem CID | 113080191 |
| Molecular Formula | C15H18Cl2N2O2 |
| Molecular Weight | 329.23 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | [4-(2,4-dichlorophenyl)piperazin-1-yl]-(oxolan-2-yl)methanone |
| SMILES | O=C(C1CCCO1)N1CCN(c2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C15H18Cl2N2O2/c16-11-3-4-13(12(17)10-11)18-5-7-19(8-6-18)15(20)14-2-1-9-21-14/h3-4,10,14H,1-2,5-9H2 |
| InChIKey | OFALBXWULTUTRB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.23 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |