C16H21ClN2O4S — CID 47027374
[4-(5-chloro-2-methylphenyl)sulfonylpiperazin-1-yl]-(oxolan-2-yl)methanone (PubChem CID 47027374) has the molecular formula C16H21ClN2O4S and a molecular weight of 372.87 g/mol. Its IUPAC name is [4-(5-chloro-2-methylphenyl)sulfonylpiperazin-1-yl]-(oxolan-2-yl)methanone.
| Compound Name | [4-(5-chloro-2-methylphenyl)sulfonylpiperazin-1-yl]-(oxolan-2-yl)methanone |
|---|---|
| PubChem CID | 47027374 |
| Molecular Formula | C16H21ClN2O4S |
| Molecular Weight | 372.87 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | [4-(5-chloro-2-methylphenyl)sulfonylpiperazin-1-yl]-(oxolan-2-yl)methanone |
| SMILES | Cc1ccc(Cl)cc1S(=O)(=O)N1CCN(C(=O)C2CCCO2)CC1 |
| InChI | InChI=1S/C16H21ClN2O4S/c1-12-4-5-13(17)11-15(12)24(21,22)19-8-6-18(7-9-19)16(20)14-3-2-10-23-14/h4-5,11,14H,2-3,6-10H2,1H3 |
| InChIKey | OJRDSDCINUSXAT-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.87 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |