C16H18ClF3N2O4S — CID 55352620
[4-[4-chloro-2-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]-(oxolan-2-yl)methanone (PubChem CID 55352620) has the molecular formula C16H18ClF3N2O4S and a molecular weight of 426.84 g/mol. Its IUPAC name is [4-[4-chloro-2-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]-(oxolan-2-yl)methanone.
| Compound Name | [4-[4-chloro-2-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]-(oxolan-2-yl)methanone |
|---|---|
| PubChem CID | 55352620 |
| Molecular Formula | C16H18ClF3N2O4S |
| Molecular Weight | 426.84 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | [4-[4-chloro-2-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]-(oxolan-2-yl)methanone |
| SMILES | O=C(C1CCCO1)N1CCN(S(=O)(=O)c2ccc(Cl)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C16H18ClF3N2O4S/c17-11-3-4-14(12(10-11)16(18,19)20)27(24,25)22-7-5-21(6-8-22)15(23)13-2-1-9-26-13/h3-4,10,13H,1-2,5-9H2 |
| InChIKey | QZGCHIPIDRKESK-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.84 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |