C11H11ClF3NO3S — CID 79031548
(3S)-1-[4-chloro-2-(trifluoromethyl)phenyl]sulfonylpyrrolidin-3-ol (PubChem CID 79031548) has the molecular formula C11H11ClF3NO3S and a molecular weight of 329.73 g/mol. Its IUPAC name is (3S)-1-[4-chloro-2-(trifluoromethyl)phenyl]sulfonylpyrrolidin-3-ol.
| Compound Name | (3S)-1-[4-chloro-2-(trifluoromethyl)phenyl]sulfonylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 79031548 |
| Molecular Formula | C11H11ClF3NO3S |
| Molecular Weight | 329.73 g/mol |
| Exact Mass | 329.01 |
| IUPAC Name | (3S)-1-[4-chloro-2-(trifluoromethyl)phenyl]sulfonylpyrrolidin-3-ol |
| SMILES | O=S(=O)(c1ccc(Cl)cc1C(F)(F)F)N1CC[C@H](O)C1 |
| InChI | InChI=1S/C11H11ClF3NO3S/c12-7-1-2-10(9(5-7)11(13,14)15)20(18,19)16-4-3-8(17)6-16/h1-2,5,8,17H,3-4,6H2/t8-/m0/s1 |
| InChIKey | CXOXIJXZJQPRCS-QMMMGPOBSA-N |
| XLogP | 2.11 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.73 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |