C10H11ClFNO3S — CID 66291100
(3R)-1-(2-chloro-4-fluorophenyl)sulfonylpyrrolidin-3-ol (PubChem CID 66291100) has the molecular formula C10H11ClFNO3S and a molecular weight of 279.72 g/mol. Its IUPAC name is (3R)-1-(2-chloro-4-fluorophenyl)sulfonylpyrrolidin-3-ol.
| Compound Name | (3R)-1-(2-chloro-4-fluorophenyl)sulfonylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 66291100 |
| Molecular Formula | C10H11ClFNO3S |
| Molecular Weight | 279.72 g/mol |
| Exact Mass | 279.01 |
| IUPAC Name | (3R)-1-(2-chloro-4-fluorophenyl)sulfonylpyrrolidin-3-ol |
| SMILES | O=S(=O)(c1ccc(F)cc1Cl)N1CC[C@@H](O)C1 |
| InChI | InChI=1S/C10H11ClFNO3S/c11-9-5-7(12)1-2-10(9)17(15,16)13-4-3-8(14)6-13/h1-2,5,8,14H,3-4,6H2/t8-/m1/s1 |
| InChIKey | PJWOKZRDLFYGMG-MRVPVSSYSA-N |
| XLogP | 1.23 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.72 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |