C10H13FN2O3S — CID 94895330
(3R)-1-(2-amino-5-fluorophenyl)sulfonylpyrrolidin-3-ol (PubChem CID 94895330) has the molecular formula C10H13FN2O3S and a molecular weight of 260.29 g/mol. Its IUPAC name is (3R)-1-(2-amino-5-fluorophenyl)sulfonylpyrrolidin-3-ol.
| Compound Name | (3R)-1-(2-amino-5-fluorophenyl)sulfonylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 94895330 |
| Molecular Formula | C10H13FN2O3S |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | (3R)-1-(2-amino-5-fluorophenyl)sulfonylpyrrolidin-3-ol |
| SMILES | Nc1ccc(F)cc1S(=O)(=O)N1CC[C@@H](O)C1 |
| InChI | InChI=1S/C10H13FN2O3S/c11-7-1-2-9(12)10(5-7)17(15,16)13-4-3-8(14)6-13/h1-2,5,8,14H,3-4,6,12H2/t8-/m1/s1 |
| InChIKey | VJRVSYDHVRUUBZ-MRVPVSSYSA-N |
| XLogP | 0.16 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|