C17H24ClFN2O2S — CID 86900548
1-[1-(2-chloro-4-fluorophenyl)sulfonylpiperidin-3-yl]azepane (PubChem CID 86900548) has the molecular formula C17H24ClFN2O2S and a molecular weight of 374.91 g/mol. Its IUPAC name is 1-[1-(2-chloro-4-fluorophenyl)sulfonylpiperidin-3-yl]azepane.
| Compound Name | 1-[1-(2-chloro-4-fluorophenyl)sulfonylpiperidin-3-yl]azepane |
|---|---|
| PubChem CID | 86900548 |
| Molecular Formula | C17H24ClFN2O2S |
| Molecular Weight | 374.91 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 1-[1-(2-chloro-4-fluorophenyl)sulfonylpiperidin-3-yl]azepane |
| SMILES | O=S(=O)(c1ccc(F)cc1Cl)N1CCCC(N2CCCCCC2)C1 |
| InChI | InChI=1S/C17H24ClFN2O2S/c18-16-12-14(19)7-8-17(16)24(22,23)21-11-5-6-15(13-21)20-9-3-1-2-4-10-20/h7-8,12,15H,1-6,9-11,13H2 |
| InChIKey | NEPCVINHJFRBKH-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.91 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |