C10H10Cl2FNO3S — CID 103088611
(3R)-1-(2,4-dichloro-3-fluorophenyl)sulfonylpyrrolidin-3-ol (PubChem CID 103088611) has the molecular formula C10H10Cl2FNO3S and a molecular weight of 314.17 g/mol. Its IUPAC name is (3R)-1-(2,4-dichloro-3-fluorophenyl)sulfonylpyrrolidin-3-ol.
| Compound Name | (3R)-1-(2,4-dichloro-3-fluorophenyl)sulfonylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 103088611 |
| Molecular Formula | C10H10Cl2FNO3S |
| Molecular Weight | 314.17 g/mol |
| Exact Mass | 312.97 |
| IUPAC Name | (3R)-1-(2,4-dichloro-3-fluorophenyl)sulfonylpyrrolidin-3-ol |
| SMILES | O=S(=O)(c1ccc(Cl)c(F)c1Cl)N1CC[C@@H](O)C1 |
| InChI | InChI=1S/C10H10Cl2FNO3S/c11-7-1-2-8(9(12)10(7)13)18(16,17)14-4-3-6(15)5-14/h1-2,6,15H,3-5H2/t6-/m1/s1 |
| InChIKey | RVQDVKLZSWLZDH-ZCFIWIBFSA-N |
| XLogP | 1.89 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.17 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|