C12H11Cl2FN2O2S — CID 91651723
1-(2,4-dichloro-3-fluorophenyl)sulfonylpiperidine-4-carbonitrile (PubChem CID 91651723) has the molecular formula C12H11Cl2FN2O2S and a molecular weight of 337.20 g/mol. Its IUPAC name is 1-(2,4-dichloro-3-fluorophenyl)sulfonylpiperidine-4-carbonitrile.
| Compound Name | 1-(2,4-dichloro-3-fluorophenyl)sulfonylpiperidine-4-carbonitrile |
|---|---|
| PubChem CID | 91651723 |
| Molecular Formula | C12H11Cl2FN2O2S |
| Molecular Weight | 337.20 g/mol |
| Exact Mass | 335.99 |
| IUPAC Name | 1-(2,4-dichloro-3-fluorophenyl)sulfonylpiperidine-4-carbonitrile |
| SMILES | N#CC1CCN(S(=O)(=O)c2ccc(Cl)c(F)c2Cl)CC1 |
| InChI | InChI=1S/C12H11Cl2FN2O2S/c13-9-1-2-10(11(14)12(9)15)20(18,19)17-5-3-8(7-16)4-6-17/h1-2,8H,3-6H2 |
| InChIKey | XWWAACHOEJOQQO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.20 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|