C12H13BrCl2FNO2S — CID 103089679
4-(bromomethyl)-1-(2,4-dichloro-3-fluorophenyl)sulfonylpiperidine (PubChem CID 103089679) has the molecular formula C12H13BrCl2FNO2S and a molecular weight of 405.12 g/mol. Its IUPAC name is 4-(bromomethyl)-1-(2,4-dichloro-3-fluorophenyl)sulfonylpiperidine.
| Compound Name | 4-(bromomethyl)-1-(2,4-dichloro-3-fluorophenyl)sulfonylpiperidine |
|---|---|
| PubChem CID | 103089679 |
| Molecular Formula | C12H13BrCl2FNO2S |
| Molecular Weight | 405.12 g/mol |
| Exact Mass | 402.92 |
| IUPAC Name | 4-(bromomethyl)-1-(2,4-dichloro-3-fluorophenyl)sulfonylpiperidine |
| SMILES | O=S(=O)(c1ccc(Cl)c(F)c1Cl)N1CCC(CBr)CC1 |
| InChI | InChI=1S/C12H13BrCl2FNO2S/c13-7-8-3-5-17(6-4-8)20(18,19)10-2-1-9(14)12(16)11(10)15/h1-2,8H,3-7H2 |
| InChIKey | ITOZGMHUGGEPNB-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.12 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|