C10H12BrCl2NO2S2 — CID 80670130
4-(bromomethyl)-1-(2,5-dichlorothiophen-3-yl)sulfonylpiperidine (PubChem CID 80670130) has the molecular formula C10H12BrCl2NO2S2 and a molecular weight of 393.16 g/mol. Its IUPAC name is 4-(bromomethyl)-1-(2,5-dichlorothiophen-3-yl)sulfonylpiperidine.
| Compound Name | 4-(bromomethyl)-1-(2,5-dichlorothiophen-3-yl)sulfonylpiperidine |
|---|---|
| PubChem CID | 80670130 |
| Molecular Formula | C10H12BrCl2NO2S2 |
| Molecular Weight | 393.16 g/mol |
| Exact Mass | 390.89 |
| IUPAC Name | 4-(bromomethyl)-1-(2,5-dichlorothiophen-3-yl)sulfonylpiperidine |
| SMILES | O=S(=O)(c1cc(Cl)sc1Cl)N1CCC(CBr)CC1 |
| InChI | InChI=1S/C10H12BrCl2NO2S2/c11-6-7-1-3-14(4-2-7)18(15,16)8-5-9(12)17-10(8)13/h5,7H,1-4,6H2 |
| InChIKey | KYIBPXNVWBHCRA-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.16 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|