C8H10Cl2N2O2S2 — CID 43344137
1-(2,5-dichlorothiophen-3-yl)sulfonylpiperazine (PubChem CID 43344137) has the molecular formula C8H10Cl2N2O2S2 and a molecular weight of 301.22 g/mol. Its IUPAC name is 1-(2,5-dichlorothiophen-3-yl)sulfonylpiperazine.
| Compound Name | 1-(2,5-dichlorothiophen-3-yl)sulfonylpiperazine |
|---|---|
| PubChem CID | 43344137 |
| Molecular Formula | C8H10Cl2N2O2S2 |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 299.96 |
| IUPAC Name | 1-(2,5-dichlorothiophen-3-yl)sulfonylpiperazine |
| SMILES | O=S(=O)(c1cc(Cl)sc1Cl)N1CCNCC1 |
| InChI | InChI=1S/C8H10Cl2N2O2S2/c9-7-5-6(8(10)15-7)16(13,14)12-3-1-11-2-4-12/h5,11H,1-4H2 |
| InChIKey | MZYYCYUXLGICCV-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |