About 1-(2,5-dichlorothiophen-3-yl)sulfonylpiperazine
1-(2,5-dichlorothiophen-3-yl)sulfonylpiperazine (PubChem CID 43344137) has the molecular formula C8H10Cl2N2O2S2
and a molecular weight of 301.22 g/mol. Its IUPAC name is 1-(2,5-dichlorothiophen-3-yl)sulfonylpiperazine.
Molecular Properties
| Compound Name | 1-(2,5-dichlorothiophen-3-yl)sulfonylpiperazine |
| PubChem CID | 43344137 |
| Molecular Formula | C8H10Cl2N2O2S2 |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 299.96 |
| IUPAC Name | 1-(2,5-dichlorothiophen-3-yl)sulfonylpiperazine |
| SMILES | O=S(=O)(c1cc(Cl)sc1Cl)N1CCNCC1 |
| InChI | InChI=1S/C8H10Cl2N2O2S2/c9-7-5-6(8(10)15-7)16(13,14)12-3-1-11-2-4-12/h5,11H,1-4H2 |
| InChIKey | MZYYCYUXLGICCV-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2,5-dichlorothiophen-3-yl)sulfonylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,5-dichlorothiophen-3-yl)sulfonylpiperazine?
The IUPAC name of 1-(2,5-dichlorothiophen-3-yl)sulfonylpiperazine (CID 43344137) is 1-(2,5-dichlorothiophen-3-yl)sulfonylpiperazine.
What is the SMILES notation for 1-(2,5-dichlorothiophen-3-yl)sulfonylpiperazine?
The canonical SMILES for 1-(2,5-dichlorothiophen-3-yl)sulfonylpiperazine is O=S(=O)(c1cc(Cl)sc1Cl)N1CCNCC1.
What is the InChIKey of 1-(2,5-dichlorothiophen-3-yl)sulfonylpiperazine?
The InChIKey is MZYYCYUXLGICCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10Cl2N2O2S2/c9-7-5-6(8(10)15-7)16(13,14)12-3-1-11-2-4-12/h5,11H,1-4H2.
What are the key properties of 1-(2,5-dichlorothiophen-3-yl)sulfonylpiperazine?
1-(2,5-dichlorothiophen-3-yl)sulfonylpiperazine has a molecular weight of 301.22 g/mol, XLogP of 1.65, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,5-dichlorothiophen-3-yl)sulfonylpiperazine is sourced from PubChem (CID 43344137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).