C10H14Cl2N2O2S2 — CID 43605263
[1-(2,5-dichlorothiophen-3-yl)sulfonylpiperidin-4-yl]methanamine (PubChem CID 43605263) has the molecular formula C10H14Cl2N2O2S2 and a molecular weight of 329.27 g/mol. Its IUPAC name is [1-(2,5-dichlorothiophen-3-yl)sulfonylpiperidin-4-yl]methanamine.
| Compound Name | [1-(2,5-dichlorothiophen-3-yl)sulfonylpiperidin-4-yl]methanamine |
|---|---|
| PubChem CID | 43605263 |
| Molecular Formula | C10H14Cl2N2O2S2 |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 327.99 |
| IUPAC Name | [1-(2,5-dichlorothiophen-3-yl)sulfonylpiperidin-4-yl]methanamine |
| SMILES | NCC1CCN(S(=O)(=O)c2cc(Cl)sc2Cl)CC1 |
| InChI | InChI=1S/C10H14Cl2N2O2S2/c11-9-5-8(10(12)17-9)18(15,16)14-3-1-7(6-13)2-4-14/h5,7H,1-4,6,13H2 |
| InChIKey | DWJFAVLZUYIAGE-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |