C12H14Cl2FNO3S — CID 99828026
(3S,4S)-1-(2,4-dichloro-3-fluorophenyl)sulfonyl-3-methylpiperidin-4-ol (PubChem CID 99828026) has the molecular formula C12H14Cl2FNO3S and a molecular weight of 342.22 g/mol. Its IUPAC name is (3S,4S)-1-(2,4-dichloro-3-fluorophenyl)sulfonyl-3-methylpiperidin-4-ol.
| Compound Name | (3S,4S)-1-(2,4-dichloro-3-fluorophenyl)sulfonyl-3-methylpiperidin-4-ol |
|---|---|
| PubChem CID | 99828026 |
| Molecular Formula | C12H14Cl2FNO3S |
| Molecular Weight | 342.22 g/mol |
| Exact Mass | 341.01 |
| IUPAC Name | (3S,4S)-1-(2,4-dichloro-3-fluorophenyl)sulfonyl-3-methylpiperidin-4-ol |
| SMILES | C[C@H]1CN(S(=O)(=O)c2ccc(Cl)c(F)c2Cl)CC[C@@H]1O |
| InChI | InChI=1S/C12H14Cl2FNO3S/c1-7-6-16(5-4-9(7)17)20(18,19)10-3-2-8(13)12(15)11(10)14/h2-3,7,9,17H,4-6H2,1H3/t7-,9-/m0/s1 |
| InChIKey | DBVCZHVUFJHZDS-CBAPKCEASA-N |
| XLogP | 2.52 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.22 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|