C19H20Cl2F2N2O3S — CID 129212997
1-[2-chloro-5-[(3-chloro-4,5-difluoroanilino)methyl]phenyl]sulfonyl-3-methylpiperidin-4-ol (PubChem CID 129212997) has the molecular formula C19H20Cl2F2N2O3S and a molecular weight of 465.35 g/mol. Its IUPAC name is 1-[2-chloro-5-[(3-chloro-4,5-difluoroanilino)methyl]phenyl]sulfonyl-3-methylpiperidin-4-ol.
| Compound Name | 1-[2-chloro-5-[(3-chloro-4,5-difluoroanilino)methyl]phenyl]sulfonyl-3-methylpiperidin-4-ol |
|---|---|
| PubChem CID | 129212997 |
| Molecular Formula | C19H20Cl2F2N2O3S |
| Molecular Weight | 465.35 g/mol |
| Exact Mass | 464.05 |
| IUPAC Name | 1-[2-chloro-5-[(3-chloro-4,5-difluoroanilino)methyl]phenyl]sulfonyl-3-methylpiperidin-4-ol |
| SMILES | CC1CN(S(=O)(=O)c2cc(CNc3cc(F)c(F)c(Cl)c3)ccc2Cl)CCC1O |
| InChI | InChI=1S/C19H20Cl2F2N2O3S/c1-11-10-25(5-4-17(11)26)29(27,28)18-6-12(2-3-14(18)20)9-24-13-7-15(21)19(23)16(22)8-13/h2-3,6-8,11,17,24,26H,4-5,9-10H2,1H3 |
| InChIKey | KNLGNJXSNBWIHD-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.35 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|