C11H11Cl2FN2O3S — CID 103088337
N-[1-(2,4-dichloro-3-fluorophenyl)sulfonylpiperidin-4-ylidene]hydroxylamine (PubChem CID 103088337) has the molecular formula C11H11Cl2FN2O3S and a molecular weight of 341.19 g/mol. Its IUPAC name is N-[1-(2,4-dichloro-3-fluorophenyl)sulfonylpiperidin-4-ylidene]hydroxylamine.
| Compound Name | N-[1-(2,4-dichloro-3-fluorophenyl)sulfonylpiperidin-4-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 103088337 |
| Molecular Formula | C11H11Cl2FN2O3S |
| Molecular Weight | 341.19 g/mol |
| Exact Mass | 339.99 |
| IUPAC Name | N-[1-(2,4-dichloro-3-fluorophenyl)sulfonylpiperidin-4-ylidene]hydroxylamine |
| SMILES | O=S(=O)(c1ccc(Cl)c(F)c1Cl)N1CCC(=NO)CC1 |
| InChI | InChI=1S/C11H11Cl2FN2O3S/c12-8-1-2-9(10(13)11(8)14)20(18,19)16-5-3-7(15-17)4-6-16/h1-2,17H,3-6H2 |
| InChIKey | PSEOLNVTGVQYDP-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.19 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|