C11H11Cl2FN2O2S2 — CID 103088168
1-(2,4-dichloro-3-fluorophenyl)sulfonylpyrrolidine-2-carbothioamide (PubChem CID 103088168) has the molecular formula C11H11Cl2FN2O2S2 and a molecular weight of 357.26 g/mol. Its IUPAC name is 1-(2,4-dichloro-3-fluorophenyl)sulfonylpyrrolidine-2-carbothioamide.
| Compound Name | 1-(2,4-dichloro-3-fluorophenyl)sulfonylpyrrolidine-2-carbothioamide |
|---|---|
| PubChem CID | 103088168 |
| Molecular Formula | C11H11Cl2FN2O2S2 |
| Molecular Weight | 357.26 g/mol |
| Exact Mass | 355.96 |
| IUPAC Name | 1-(2,4-dichloro-3-fluorophenyl)sulfonylpyrrolidine-2-carbothioamide |
| SMILES | NC(=S)C1CCCN1S(=O)(=O)c1ccc(Cl)c(F)c1Cl |
| InChI | InChI=1S/C11H11Cl2FN2O2S2/c12-6-3-4-8(9(13)10(6)14)20(17,18)16-5-1-2-7(16)11(15)19/h3-4,7H,1-2,5H2,(H2,15,19) |
| InChIKey | UOISAFHGRXGFAY-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.26 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|