C13H16Cl2FNO3S — CID 103088583
2,4-dichloro-3-fluoro-N-[[2-(hydroxymethyl)cyclopentyl]methyl]benzenesulfonamide (PubChem CID 103088583) has the molecular formula C13H16Cl2FNO3S and a molecular weight of 356.25 g/mol. Its IUPAC name is 2,4-dichloro-3-fluoro-N-[[2-(hydroxymethyl)cyclopentyl]methyl]benzenesulfonamide.
| Compound Name | 2,4-dichloro-3-fluoro-N-[[2-(hydroxymethyl)cyclopentyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 103088583 |
| Molecular Formula | C13H16Cl2FNO3S |
| Molecular Weight | 356.25 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | 2,4-dichloro-3-fluoro-N-[[2-(hydroxymethyl)cyclopentyl]methyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCC1CCCC1CO)c1ccc(Cl)c(F)c1Cl |
| InChI | InChI=1S/C13H16Cl2FNO3S/c14-10-4-5-11(12(15)13(10)16)21(19,20)17-6-8-2-1-3-9(8)7-18/h4-5,8-9,17-18H,1-3,6-7H2 |
| InChIKey | JUISXPGDVMHWMK-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.25 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|