C12H16Cl3FN2O2S — CID 120711122
N-[2-(aminomethyl)cyclopentyl]-2,4-dichloro-3-fluorobenzenesulfonamide;hydrochloride (PubChem CID 120711122) has the molecular formula C12H16Cl3FN2O2S and a molecular weight of 377.70 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclopentyl]-2,4-dichloro-3-fluorobenzenesulfonamide;hydrochloride.
| Compound Name | N-[2-(aminomethyl)cyclopentyl]-2,4-dichloro-3-fluorobenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120711122 |
| Molecular Formula | C12H16Cl3FN2O2S |
| Molecular Weight | 377.70 g/mol |
| Exact Mass | 376.00 |
| IUPAC Name | N-[2-(aminomethyl)cyclopentyl]-2,4-dichloro-3-fluorobenzenesulfonamide;hydrochloride |
| SMILES | Cl.NCC1CCCC1NS(=O)(=O)c1ccc(Cl)c(F)c1Cl |
| InChI | InChI=1S/C12H15Cl2FN2O2S.ClH/c13-8-4-5-10(11(14)12(8)15)20(18,19)17-9-3-1-2-7(9)6-16;/h4-5,7,9,17H,1-3,6,16H2;1H |
| InChIKey | PPQNSPPVAUYRBZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.70 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|