C12H17Cl2FN2O2S — CID 120711092
N-[2-(aminomethyl)cyclopentyl]-2-chloro-6-fluorobenzenesulfonamide;hydrochloride (PubChem CID 120711092) has the molecular formula C12H17Cl2FN2O2S and a molecular weight of 343.25 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclopentyl]-2-chloro-6-fluorobenzenesulfonamide;hydrochloride.
| Compound Name | N-[2-(aminomethyl)cyclopentyl]-2-chloro-6-fluorobenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120711092 |
| Molecular Formula | C12H17Cl2FN2O2S |
| Molecular Weight | 343.25 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | N-[2-(aminomethyl)cyclopentyl]-2-chloro-6-fluorobenzenesulfonamide;hydrochloride |
| SMILES | Cl.NCC1CCCC1NS(=O)(=O)c1c(F)cccc1Cl |
| InChI | InChI=1S/C12H16ClFN2O2S.ClH/c13-9-4-2-5-10(14)12(9)19(17,18)16-11-6-1-3-8(11)7-15;/h2,4-5,8,11,16H,1,3,6-7,15H2;1H |
| InChIKey | JFTOWVLQAPNYQV-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.25 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |