C12H17FN2O2S — CID 94903895
N-[(1R,2R)-2-(aminomethyl)cyclopentyl]-2-fluorobenzenesulfonamide (PubChem CID 94903895) has the molecular formula C12H17FN2O2S and a molecular weight of 272.34 g/mol. Its IUPAC name is N-[(1R,2R)-2-(aminomethyl)cyclopentyl]-2-fluorobenzenesulfonamide.
| Compound Name | N-[(1R,2R)-2-(aminomethyl)cyclopentyl]-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 94903895 |
| Molecular Formula | C12H17FN2O2S |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | N-[(1R,2R)-2-(aminomethyl)cyclopentyl]-2-fluorobenzenesulfonamide |
| SMILES | NC[C@H]1CCC[C@H]1NS(=O)(=O)c1ccccc1F |
| InChI | InChI=1S/C12H17FN2O2S/c13-10-5-1-2-7-12(10)18(16,17)15-11-6-3-4-9(11)8-14/h1-2,5,7,9,11,15H,3-4,6,8,14H2/t9-,11-/m1/s1 |
| InChIKey | YKXNHYYOEPBVAE-MWLCHTKSSA-N |
| XLogP | 1.23 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |