C12H16FN3O3S — CID 76978995
2-[(2-fluorophenyl)sulfonylamino]-N'-hydroxycyclopentane-1-carboximidamide (PubChem CID 76978995) has the molecular formula C12H16FN3O3S and a molecular weight of 301.34 g/mol. Its IUPAC name is 2-[(2-fluorophenyl)sulfonylamino]-N'-hydroxycyclopentane-1-carboximidamide.
| Compound Name | 2-[(2-fluorophenyl)sulfonylamino]-N'-hydroxycyclopentane-1-carboximidamide |
|---|---|
| PubChem CID | 76978995 |
| Molecular Formula | C12H16FN3O3S |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 2-[(2-fluorophenyl)sulfonylamino]-N'-hydroxycyclopentane-1-carboximidamide |
| SMILES | NC(=NO)C1CCCC1NS(=O)(=O)c1ccccc1F |
| InChI | InChI=1S/C12H16FN3O3S/c13-9-5-1-2-7-11(9)20(18,19)16-10-6-3-4-8(10)12(14)15-17/h1-2,5,7-8,10,16-17H,3-4,6H2,(H2,14,15) |
| InChIKey | QMGXDHAAVKKSMJ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|