C12H14F2N2O3S — CID 71997271
2-[(2,3-difluorophenyl)sulfonylamino]cyclopentane-1-carboxamide (PubChem CID 71997271) has the molecular formula C12H14F2N2O3S and a molecular weight of 304.32 g/mol. Its IUPAC name is 2-[(2,3-difluorophenyl)sulfonylamino]cyclopentane-1-carboxamide.
| Compound Name | 2-[(2,3-difluorophenyl)sulfonylamino]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 71997271 |
| Molecular Formula | C12H14F2N2O3S |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 2-[(2,3-difluorophenyl)sulfonylamino]cyclopentane-1-carboxamide |
| SMILES | NC(=O)C1CCCC1NS(=O)(=O)c1cccc(F)c1F |
| InChI | InChI=1S/C12H14F2N2O3S/c13-8-4-2-6-10(11(8)14)20(18,19)16-9-5-1-3-7(9)12(15)17/h2,4,6-7,9,16H,1,3,5H2,(H2,15,17) |
| InChIKey | QCKFYONHOTZIEV-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |