C13H15F3N2O3S — CID 71854613
2-[(2,3,4-trifluorophenyl)sulfonylamino]cyclohexane-1-carboxamide (PubChem CID 71854613) has the molecular formula C13H15F3N2O3S and a molecular weight of 336.34 g/mol. Its IUPAC name is 2-[(2,3,4-trifluorophenyl)sulfonylamino]cyclohexane-1-carboxamide.
| Compound Name | 2-[(2,3,4-trifluorophenyl)sulfonylamino]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 71854613 |
| Molecular Formula | C13H15F3N2O3S |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 2-[(2,3,4-trifluorophenyl)sulfonylamino]cyclohexane-1-carboxamide |
| SMILES | NC(=O)C1CCCCC1NS(=O)(=O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C13H15F3N2O3S/c14-8-5-6-10(12(16)11(8)15)22(20,21)18-9-4-2-1-3-7(9)13(17)19/h5-7,9,18H,1-4H2,(H2,17,19) |
| InChIKey | PSMRDHSFLUORAM-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|