C13H17F3N2O2S — CID 79118102
2,3,4-trifluoro-N-[4-(methylamino)cyclohexyl]benzenesulfonamide (PubChem CID 79118102) has the molecular formula C13H17F3N2O2S and a molecular weight of 322.35 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-[4-(methylamino)cyclohexyl]benzenesulfonamide.
| Compound Name | 2,3,4-trifluoro-N-[4-(methylamino)cyclohexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 79118102 |
| Molecular Formula | C13H17F3N2O2S |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 2,3,4-trifluoro-N-[4-(methylamino)cyclohexyl]benzenesulfonamide |
| SMILES | CNC1CCC(NS(=O)(=O)c2ccc(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C13H17F3N2O2S/c1-17-8-2-4-9(5-3-8)18-21(19,20)11-7-6-10(14)12(15)13(11)16/h6-9,17-18H,2-5H2,1H3 |
| InChIKey | GVVACZHPNPRIEI-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|