C16H18N2O3S — CID 97001353
trans-(1S,2S)-2-(naphthalen-1-ylsulfonylamino)cyclopentane-1-carboxamide (PubChem CID 97001353) has the molecular formula C16H18N2O3S and a molecular weight of 318.40 g/mol. Its IUPAC name is trans-(1S,2S)-2-(naphthalen-1-ylsulfonylamino)cyclopentane-1-carboxamide.
| Compound Name | trans-(1S,2S)-2-(naphthalen-1-ylsulfonylamino)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 97001353 |
| Molecular Formula | C16H18N2O3S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | trans-(1S,2S)-2-(naphthalen-1-ylsulfonylamino)cyclopentane-1-carboxamide |
| SMILES | NC(=O)[C@H]1CCC[C@@H]1NS(=O)(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C16H18N2O3S/c17-16(19)13-8-4-9-14(13)18-22(20,21)15-10-3-6-11-5-1-2-7-12(11)15/h1-3,5-7,10,13-14,18H,4,8-9H2,(H2,17,19)/t13-,14-/m0/s1 |
| InChIKey | VGBYJMRDVHINGT-KBPBESRZSA-N |
| XLogP | 1.77 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |