C17H23ClN2O2S — CID 119986179
N-[2-(aminomethyl)cyclohexyl]naphthalene-1-sulfonamide;hydrochloride (PubChem CID 119986179) has the molecular formula C17H23ClN2O2S and a molecular weight of 354.90 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclohexyl]naphthalene-1-sulfonamide;hydrochloride.
| Compound Name | N-[2-(aminomethyl)cyclohexyl]naphthalene-1-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119986179 |
| Molecular Formula | C17H23ClN2O2S |
| Molecular Weight | 354.90 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | N-[2-(aminomethyl)cyclohexyl]naphthalene-1-sulfonamide;hydrochloride |
| SMILES | Cl.NCC1CCCCC1NS(=O)(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C17H22N2O2S.ClH/c18-12-14-7-2-4-10-16(14)19-22(20,21)17-11-5-8-13-6-1-3-9-15(13)17;/h1,3,5-6,8-9,11,14,16,19H,2,4,7,10,12,18H2;1H |
| InChIKey | LRLJDULFUZTBKK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.90 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |