C13H21ClN2O2S2 — CID 120711069
N-[2-(aminomethyl)cyclopentyl]-2-methylsulfanylbenzenesulfonamide;hydrochloride (PubChem CID 120711069) has the molecular formula C13H21ClN2O2S2 and a molecular weight of 336.91 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclopentyl]-2-methylsulfanylbenzenesulfonamide;hydrochloride.
| Compound Name | N-[2-(aminomethyl)cyclopentyl]-2-methylsulfanylbenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120711069 |
| Molecular Formula | C13H21ClN2O2S2 |
| Molecular Weight | 336.91 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | N-[2-(aminomethyl)cyclopentyl]-2-methylsulfanylbenzenesulfonamide;hydrochloride |
| SMILES | CSc1ccccc1S(=O)(=O)NC1CCCC1CN.Cl |
| InChI | InChI=1S/C13H20N2O2S2.ClH/c1-18-12-7-2-3-8-13(12)19(16,17)15-11-6-4-5-10(11)9-14;/h2-3,7-8,10-11,15H,4-6,9,14H2,1H3;1H |
| InChIKey | XJSIKVPAZZWMBR-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.91 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |