C12H15F3N2O2S — CID 93453513
N-[(1R,2R)-2-aminocyclohexyl]-2,3,4-trifluorobenzenesulfonamide (PubChem CID 93453513) has the molecular formula C12H15F3N2O2S and a molecular weight of 308.33 g/mol. Its IUPAC name is N-[(1R,2R)-2-aminocyclohexyl]-2,3,4-trifluorobenzenesulfonamide.
| Compound Name | N-[(1R,2R)-2-aminocyclohexyl]-2,3,4-trifluorobenzenesulfonamide |
|---|---|
| PubChem CID | 93453513 |
| Molecular Formula | C12H15F3N2O2S |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | N-[(1R,2R)-2-aminocyclohexyl]-2,3,4-trifluorobenzenesulfonamide |
| SMILES | N[C@@H]1CCCC[C@H]1NS(=O)(=O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C12H15F3N2O2S/c13-7-5-6-10(12(15)11(7)14)20(18,19)17-9-4-2-1-3-8(9)16/h5-6,8-9,17H,1-4,16H2/t8-,9-/m1/s1 |
| InChIKey | WFZQVMDEFCWGKH-RKDXNWHRSA-N |
| XLogP | 1.65 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|